Table of Contents
What is the structure of 2 Methyl 3 Hexyne?
Identification of 2-Methyl-3-hexyne Chemical Compound
| Chemical Formula | C7H12 |
|---|---|
| Molecular Weight | 96.17018 g/mol |
| IUPAC Name | 2-methylhex-3-yne |
| SMILES String | CCC#CC(C)C |
| InChI | InChI=1S/C7H12/c1-4-5-6-7(2)3/h7H,4H2,1-3H3 |
What is the structure of 2 Methyl 3?
2-Methyl-3-biphenylmethanol
| PubChem CID | 596875 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C14H14O |
| Synonyms | 76350-90-8 2-Methyl-3-biphenylmethanol (2-Methyl-[1,1′-biphenyl]-3-yl)methanol 3-Hydroxymethyl-2-methylbiphenyl (2-methyl-3-phenylphenyl)methanol More… |
| Molecular Weight | 198.26 |
What is the structural formula of 2 Methyl 3 Heptyne?
3-Heptyne, 2-methyl
| PubChem CID | 529287 |
|---|---|
| Molecular Formula | C8H14 |
| Synonyms | 3-Heptyne, 2-methyl 2-methylhept-3-yne 2-Methyl-3-heptyne |
| Molecular Weight | 110.20 |
| Dates | Modify 2021-11-27 Create 2005-03-27 |
What is the structure of Hexyne?
C6H101-Hexyne / Formula
What is the structure of 5 Methyl 3 Heptyne?
5-Methyl-3-heptene | C8H16 – PubChem.
What is the structure of 2-methyl-3-pentanone?
C6H12OEthyl isopropyl ketone / Formula
What is the correct condensed structural formula for 2 Methylpentanal?
C6H12O
2-Methylpentanal | C6H12O – PubChem.
What is the structural formula for 3 Heptyne?
C7H123-heptyne / Formula
What is the structure of 2 Hexyne?
C6H102-Hexyne / Formula
Which of the following is the structure for 2 Hexyne?
2-Hexyne
| PubChem CID | 33629 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C6H10 |
| Synonyms | 2-HEXYNE Hex-2-yne 764-35-2 Methyl(propyl)acetylene Methylpropylacetylene More… |
What is the structural formula for 2 Pentyne?
C5H82-Pentyne / Formula