Table of Contents
What is the structure of 1 chloro 2 2 dimethylpropane?
1-chloro-2,2-dimethylpropane
| Compound number: | MolPort-001-787-296 |
|---|---|
| IUPAC traditional: | 1-chloro-2,2-dimethylpropane |
| SMILES: | CC(C)(C)CCl |
| InChI key: | JEKYMVBQWWZVHO-UHFFFAOYSA-N |
| Molecular formula: | C5H11Cl |
What is the structure of Methylpentane?
2-Methylpentane, trivially known as isohexane, is a branched-chain alkane with the molecular formula C6H14. It is a structural isomer of hexane composed of a methyl group bonded to the second carbon atom in a pentane chain. A review of the volatiles from the healthy human body.
What is the structure of 2 chloro 2 Methylpentane?
2-Chloro-2-methylpentane | C6H13Cl | ChemSpider.
What is the Iupac name of 1-chloro-2 2 dimethylpropane?
dimethylpropane – Neopentyl chloride
1-Chloro-2,2-dimethylpropane – Neopentyl chloride.
Which of the following is the structural formula of 1-Bromo-2 2 dimethylpropane?
C5H11Br
1-Bromo-2,2-dimethylpropane | C5H11Br – PubChem.
What is the structural formula for 2-Methylpentane?
C6H14
2-Methylpentane/Formula
What is the structure of 3 chloro 2 Methylpentane?
3-Chloro-2-methylpentane
| PubChem CID | 142259 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C6H13Cl |
| Synonyms | 3-Chloro-2-methylpentane Pentane, 3-chloro-2-methyl- 38384-05-3 3-Chloro-4-methylpentane 3-chloro-2-methyl-pentane More… |
What is the structure of 2 chloro 4 Methylpentane?
Compound with free spectra: 1 NMR
| SpectraBase Compound ID | 4RAb62p1sAl |
|---|---|
| InChI | InChI=1S/C6H13Cl/c1-5(2)4-6(3)7/h5-6H,4H2,1-3H3 |
| InChIKey | WIMBRKMSNRCNMP-UHFFFAOYSA-N |
| Mol Weight | 120.62 g/mol |
| Molecular Formula | C6H13Cl |
What is the common name of 1-chloro-2 Methylpropane?
Isobutyl chloride
Isobutyl chloride (1-chloro-2-methylpropane) is a compound of chlorine, carbon, and hydrogen.
What is the structure of 1-bromo-2 Methylbutane?
1-Bromo-2-methylbutane
| PubChem CID | 25254 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C5H11Br |
| Synonyms | 1-BROMO-2-METHYLBUTANE 10422-35-2 Butane, 1-bromo-2-methyl- 5973-11-5 1-Bromo-2-methyl butane More… |
What is the chemical formula for chloro-2-methylpentane?
1-Chloro-2-methylpentane. Molecular Formula C 6 H 13 Cl; Average mass 120.620 Da; Monoisotopic mass 120.070580 Da; ChemSpider ID 460031
What is the CID of 1-bromo-2-methylpentane?
1-Bromo-2-methylpentane. PubChem CID. 91416. Structure. Find Similar Structures. Molecular Formula. C6H13Br. Synonyms. 1-Bromo-2-methylpentane.
What is the molecular formula for c6h13cl?
Molecular Formula. C6H13Cl. Synonyms. 3-Chloro-2-methylpentane. Pentane, 3-chloro-2-methyl-. 38384-05-3. 3-Chloro-4-methylpentane. 3-chloro-2-methyl-pentane. More…