What is the chemical equation for C4?

What is the chemical equation for C4?

The Composition C-4 used by the United States Armed Forces contains 91\% RDX (“Research Department Explosive”, an explosive nitroamine), bound by a mixture of 5.3\% dioctyl sebacate (DOS) or dioctyl adipate (DOA) as the plasticizer (to increase the plasticity of the explosive), thickened with 2.1\% polyisobutylene (PIB, a …

What is the balanced chemical equation for?

A balanced equation models a chemical reaction using the formulae of the reactants and products . It shows the number of units of each substance involved.

What 3 things does a balanced chemical equation show you?

READ ALSO:   Is MEAN stack developer a full stack developer?

A Balanced Equation When a chemical equation is balanced, it is clear what substances are the reactants, which are the products, how much of each substance is involved, as well as their relationship to each other, and the steps that occur during the reaction.

What is the balanced chemical equation shampoo?

There are two alternative chemical formulas for the common household shampoo, namely, CH3(CH2)10CH2(OCH2CH2)2OSO3Na and NaC12H25SO4.

What does the 4 in C4 refer to biology?

These plants are called C4 plants, because the first product of carbon fixation is a 4-carbon compound (instead of a 3-carbon compound as in C3 or “normal” plants). C4 plants use this 4-carbon compound to effectively “concentrate” CO2 around rubisco, so that rubisco is less likely re react with O2.

What are the 4 types of chemical reactions discuss each with examples?

4 Main Types of Chemical Reactions

Type of Reaction General Reaction
Synthesis or Combination A + B → AB
Decomposition or Analysis AB → A + B
Displacement, Replacement, or Substitution A + BC → AC + B
Double displacement, Double replacement, or Metathesis AB + CD → AD + CB
READ ALSO:   Where can I get SQL training?

What is the composition of shampoo?

Shampoo is generally made by combining a surfactant, most often sodium lauryl sulfate or sodium laureth sulfate, with a co-surfactant, most often cocamidopropyl betaine in water. The sulphate ingredient acts as a surfactant, essentially heavy-duty soap that makes it easier to trap oil and grease.

What is the chemical name of shampoo?

There are two alternative chemical formulas for the common household shampoo, namely, CH3(CH2)10CH2(OCH2CH2)2OSO3Na and NaC12H25SO4. They represent sodium laureth sulfate and sodium lauryl sulfate, respectively.

What does the C4 pathway do?

1: The C4 Pathway The C4 pathway is designed to efficiently fix CO2 at low concentrations and plants that use this pathway are known as C4 plants. These plants fix CO2 into a four carbon compound (C4) called oxaloacetate. This occurs in cells called mesophyll cells.

What is the chemical composition of a C4 explosive?

The chemical composition of a C4 explosive is C30H47N3O9S. What is the balanced chemical equation for when this stuff goes boom in a real life environment? – Quora The chemical composition of a C4 explosive is C30H47N3O9S.

READ ALSO:   How do you show that a decimal is infinite?

How can you change the direction of the explosion of C4?

You can mold it into different shapes to change the direction of the explosion. The explosive material in C-4 is cyclotrimethylene-trinitramine (C3H6N6O6), commonly called RDX (which stands for “royal demolition explosive” or “research development explosive”).

What is the difference between C4 and PE 4?

C-4 (explosive) A similar British plastic explosive, based on RDX but with different plasticizer than Composition C-4, is known as PE-4 (Plastic Explosive No. 4). C-4 is composed of explosives, plastic binder, plasticizer to make it malleable, and usually a marker or odorizing taggant chemical.

Where does the US get its C4 explosives?

The U.S. military is the primary manufacturer of C-4, and it tightly guards its supply, but there are a number of other sources for similar explosive material (including Iran]